What is the (4-isobutylphenyl)acetonitrile?

(4-isobutylphenyl)acetonitrile is , while it's Molecular Formula is C12H15 N. Used in Pharmaceutical Industry: (4-isobutylphenyl)acetonitrile is used as an intermediate for the production of pharmaceuticals. Its reactive nature allows it to be a key component in the synthesis of various medicinal compounds, contributing to the development of new drugs and therapies. Used in Perfumery: In the perfume industry, (4-isobutylphenyl)acetonitrile is utilized as an intermediate for creating fragrances. Its unique chemical properties enable the production of distinct and complex scents, adding to the diversity of perfumes available on the market. Used in Organic Chemistry: (4-isobutylphenyl)acetonitrile is used as a versatile compound in organic chemistry. It acts as a precursor for other chemical reactions, allowing for the creation of a wide range of organic molecules. This makes it an essential starting material for researchers and chemists working on developing new organic compounds with potential applications in various fields. Overall, (4-isobutylphenyl)acetonitrile's applications span across different industries, highlighting its significance as a valuable intermediate and building block in the synthesis of numerous organic compounds.

What is the CAS number for (4-isobutylphenyl)acetonitrile?

The CAS number of (4-isobutylphenyl)acetonitrile is 40784-95-0.

What is (4-isobutylphenyl)acetonitrile (40784-95-0) used for?

(4-isobutylphenyl)acetonitrile, with the molecular formula C14H15N, is a colorless liquid chemical compound. It is recognized for its reactive nature and serves as a versatile building block in the synthesis of various organic molecules. (4-isobutylphenyl)acetonitrile is valued in the chemical industry for its unique chemical properties and its ability to participate in a wide array of chemical transformations, making it an important starting material for the creation of a broad spectrum of organic compounds.InChI:InChI=1/C12H15N/c1-10(2)9-12-5-3-11(4-6-12)7-8-13/h3-6,10H,7,9H2,1-2H3

What is the (4-isobutylphenyl)acetonitrile?

(4-isobutylphenyl)acetonitrile is , while it's Molecular Formula is C12H15 N. Used in Pharmaceutical Industry: (4-isobutylphenyl)acetonitrile is used as an intermediate for the production of pharmaceuticals. Its reactive nature allows it to be a key component in the synthesis of various medicinal compounds, contributing to the development of new drugs and therapies. Used in Perfumery: In the perfume industry, (4-isobutylphenyl)acetonitrile is utilized as an intermediate for creating fragrances. Its unique chemical properties enable the production of distinct and complex scents, adding to the diversity of perfumes available on the market. Used in Organic Chemistry: (4-isobutylphenyl)acetonitrile is used as a versatile compound in organic chemistry. It acts as a precursor for other chemical reactions, allowing for the creation of a wide range of organic molecules. This makes it an essential starting material for researchers and chemists working on developing new organic compounds with potential applications in various fields. Overall, (4-isobutylphenyl)acetonitrile's applications span across different industries, highlighting its significance as a valuable intermediate and building block in the synthesis of numerous organic compounds.

What is the CAS number for (4-isobutylphenyl)acetonitrile?

The CAS number of (4-isobutylphenyl)acetonitrile is 40784-95-0.

What is (4-isobutylphenyl)acetonitrile (40784-95-0) used for?

(4-isobutylphenyl)acetonitrile, with the molecular formula C14H15N, is a colorless liquid chemical compound. It is recognized for its reactive nature and serves as a versatile building block in the synthesis of various organic molecules. (4-isobutylphenyl)acetonitrile is valued in the chemical industry for its unique chemical properties and its ability to participate in a wide array of chemical transformations, making it an important starting material for the creation of a broad spectrum of organic compounds.InChI:InChI=1/C12H15N/c1-10(2)9-12-5-3-11(4-6-12)7-8-13/h3-6,10H,7,9H2,1-2H3

Others

Home - Others

(4-isobutylphenyl)acetonitrile

CAS: 40784-95-0
Purity: 99%
Cost-effective and customizable (4-isobutylphenyl)acetonitrile 40784-95-0 supplier

Inquiry

Product Detail

Cost-effective and customizable (4-isobutylphenyl)acetonitrile 40784-95-0 supplier

Molecular Formula: C12H15 N
Molecular Weight: 173.258
Vapor Pressure: 0.00387mmHg at 25°C
Boiling Point: 280.1°Cat760mmHg
Flash Point: 127.8°C
PSA： 23.79000
Density: 0.952g/cm³
LogP: 2.95118

(4-isobutylphenyl)acetonitrile(Cas 40784-95-0) Usage

General Description

(4-isobutylphenyl)acetonitrile is a chemical compound with the molecular formula C14H15N. It is a colorless liquid that is mainly used as an intermediate in the production of pharmaceuticals, perfumes, and other organic compounds. (4-isobutylphenyl)acetonitrile is also known for its potential use as a building block in the synthesis of various organic molecules, thanks to its reactive nature and ability to act as a precursor for other chemical reactions. Additionally, it is considered to be a versatile compound in organic chemistry due to its unique chemical properties and its ability to participate in a variety of chemical transformations. Overall, (4-isobutylphenyl)acetonitrile has found widespread use in the chemical industry as an important starting material for the synthesis of a wide range of organic compounds.

InChI:InChI=1/C12H15N/c1-10(2)9-12-5-3-11(4-6-12)7-8-13/h3-6,10H,7,9H2,1-2H3